C20H42BrNO3 — CID 173363645
(Z)-2-aminoicos-11-ene-1,1,1-triol;hydrobromide (PubChem CID 173363645) has the molecular formula C20H42BrNO3 and a molecular weight of 424.46 g/mol. Its IUPAC name is (Z)-2-aminoicos-11-ene-1,1,1-triol;hydrobromide.
| Compound Name | (Z)-2-aminoicos-11-ene-1,1,1-triol;hydrobromide |
|---|---|
| PubChem CID | 173363645 |
| Molecular Formula | C20H42BrNO3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (Z)-2-aminoicos-11-ene-1,1,1-triol;hydrobromide |
| SMILES | Br.CCCCCCCC/C=C\CCCCCCCCC(N)C(O)(O)O |
| InChI | InChI=1S/C20H41NO3.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(21)20(22,23)24;/h9-10,19,22-24H,2-8,11-18,21H2,1H3;1H/b10-9-; |
| InChIKey | HAHQPGGLARWKAA-KVVVOXFISA-N |
| XLogP | 4.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|