C20H39NO4 — CID 173363644
2-amino-1,1,1-trihydroxyicos-11-en-3-one (PubChem CID 173363644) has the molecular formula C20H39NO4 and a molecular weight of 357.54 g/mol. Its IUPAC name is 2-amino-1,1,1-trihydroxyicos-11-en-3-one.
| Compound Name | 2-amino-1,1,1-trihydroxyicos-11-en-3-one |
|---|---|
| PubChem CID | 173363644 |
| Molecular Formula | C20H39NO4 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | 2-amino-1,1,1-trihydroxyicos-11-en-3-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(N)C(O)(O)O |
| InChI | InChI=1S/C20H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(22)19(21)20(23,24)25/h9-10,19,23-25H,2-8,11-17,21H2,1H3 |
| InChIKey | QIRONIPVPPRNLZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|