C41H77NO3 — CID 175186248
(9Z,29Z)-19-amino-19-hydroxy-20-propan-2-yloctatriaconta-9,29-diene-18,21-dione (PubChem CID 175186248) has the molecular formula C41H77NO3 and a molecular weight of 632.07 g/mol. Its IUPAC name is (9Z,29Z)-19-amino-19-hydroxy-20-propan-2-yloctatriaconta-9,29-diene-18,21-dione.
| Compound Name | (9Z,29Z)-19-amino-19-hydroxy-20-propan-2-yloctatriaconta-9,29-diene-18,21-dione |
|---|---|
| PubChem CID | 175186248 |
| Molecular Formula | C41H77NO3 |
| Molecular Weight | 632.07 g/mol |
| Exact Mass | 631.59 |
| IUPAC Name | (9Z,29Z)-19-amino-19-hydroxy-20-propan-2-yloctatriaconta-9,29-diene-18,21-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C(C)C)C(N)(O)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C41H77NO3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(43)40(37(3)4)41(42,45)39(44)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,37,40,45H,5-18,23-36,42H2,1-4H3/b21-19-,22-20- |
| InChIKey | ITWOXNYFTYSASA-WRBBJXAJSA-N |
| XLogP | 12.12 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.07 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|