C28H52O2 — CID 173379657
(Z)-3-oxo-2,2-di(propan-2-yl)docos-13-enal (PubChem CID 173379657) has the molecular formula C28H52O2 and a molecular weight of 420.72 g/mol. Its IUPAC name is (Z)-3-oxo-2,2-di(propan-2-yl)docos-13-enal.
| Compound Name | (Z)-3-oxo-2,2-di(propan-2-yl)docos-13-enal |
|---|---|
| PubChem CID | 173379657 |
| Molecular Formula | C28H52O2 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.40 |
| IUPAC Name | (Z)-3-oxo-2,2-di(propan-2-yl)docos-13-enal |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)C(C=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H52O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(30)28(24-29,25(2)3)26(4)5/h13-14,24-26H,6-12,15-23H2,1-5H3/b14-13- |
| InChIKey | IBLQRXOZVCSDOD-YPKPFQOOSA-N |
| XLogP | 8.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|