C41H79NO2 — CID 174641729
azane;(9Z,29Z)-19,19,20-trimethyloctatriaconta-9,29-diene-18,21-dione (PubChem CID 174641729) has the molecular formula C41H79NO2 and a molecular weight of 618.09 g/mol. Its IUPAC name is azane;(9Z,29Z)-19,19,20-trimethyloctatriaconta-9,29-diene-18,21-dione.
| Compound Name | azane;(9Z,29Z)-19,19,20-trimethyloctatriaconta-9,29-diene-18,21-dione |
|---|---|
| PubChem CID | 174641729 |
| Molecular Formula | C41H79NO2 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.61 |
| IUPAC Name | azane;(9Z,29Z)-19,19,20-trimethyloctatriaconta-9,29-diene-18,21-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C)C(C)(C)C(=O)CCCCCCC/C=C\CCCCCCCC.N |
| InChI | InChI=1S/C41H76O2.H3N/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39(42)38(3)41(4,5)40(43)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,38H,6-19,24-37H2,1-5H3;1H3/b22-20-,23-21-; |
| InChIKey | WDDOGDNSIPQULB-LQDDAWAPSA-N |
| XLogP | 14.02 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|