C42H75NO2 — CID 141369765
(6Z,9Z,29Z,32Z)-19-amino-19-methyl-20-propan-2-yloctatriaconta-6,9,29,32-tetraene-18,21-dione (PubChem CID 141369765) has the molecular formula C42H75NO2 and a molecular weight of 626.07 g/mol. Its IUPAC name is (6Z,9Z,29Z,32Z)-19-amino-19-methyl-20-propan-2-yloctatriaconta-6,9,29,32-tetraene-18,21-dione.
| Compound Name | (6Z,9Z,29Z,32Z)-19-amino-19-methyl-20-propan-2-yloctatriaconta-6,9,29,32-tetraene-18,21-dione |
|---|---|
| PubChem CID | 141369765 |
| Molecular Formula | C42H75NO2 |
| Molecular Weight | 626.07 g/mol |
| Exact Mass | 625.58 |
| IUPAC Name | (6Z,9Z,29Z,32Z)-19-amino-19-methyl-20-propan-2-yloctatriaconta-6,9,29,32-tetraene-18,21-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C(C(C)C)C(C)(N)C(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H75NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39(44)41(38(3)4)42(5,43)40(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,38,41H,6-13,18-19,24-37,43H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | GJLQHUBQLROWOO-ZPPAUJSGSA-N |
| XLogP | 12.74 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.07 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|