butan-2-one;2-methylprop-2-enoic acid

C8H14O3 — CID 18674562

IUPACbutan-2-one;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.CCC(C)=O
InChIInChI=1S/C4H6O2.C4H8O/c1-3(2)4(5)6;1-3-4(2)5/h1H2,2H3,(H,5,6);3H2,1-2H3
InChIKeyDIEKHIOKJDOVQV-UHFFFAOYSA-N
MW158.20 g/mol
LogP1.63
Rot. Bonds2

About butan-2-one;2-methylprop-2-enoic acid

butan-2-one;2-methylprop-2-enoic acid (PubChem CID 18674562) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is butan-2-one;2-methylprop-2-enoic acid.

Molecular Properties

Compound Namebutan-2-one;2-methylprop-2-enoic acid
PubChem CID18674562
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Namebutan-2-one;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.CCC(C)=O
InChIInChI=1S/C4H6O2.C4H8O/c1-3(2)4(5)6;1-3-4(2)5/h1H2,2H3,(H,5,6);3H2,1-2H3
InChIKeyDIEKHIOKJDOVQV-UHFFFAOYSA-N
XLogP1.63
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze butan-2-one;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-one;2-methylprop-2-enoic acid?
The IUPAC name of butan-2-one;2-methylprop-2-enoic acid (CID 18674562) is butan-2-one;2-methylprop-2-enoic acid.
What is the SMILES notation for butan-2-one;2-methylprop-2-enoic acid?
The canonical SMILES for butan-2-one;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCC(C)=O.
What is the InChIKey of butan-2-one;2-methylprop-2-enoic acid?
The InChIKey is DIEKHIOKJDOVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C4H8O/c1-3(2)4(5)6;1-3-4(2)5/h1H2,2H3,(H,5,6);3H2,1-2H3.
What are the key properties of butan-2-one;2-methylprop-2-enoic acid?
butan-2-one;2-methylprop-2-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2-methylprop-2-enoic acid is sourced from PubChem (CID 18674562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).