About butan-2-one;2-methylprop-2-enoic acid
butan-2-one;2-methylprop-2-enoic acid (PubChem CID 18674562) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is butan-2-one;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | butan-2-one;2-methylprop-2-enoic acid |
| PubChem CID | 18674562 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | butan-2-one;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC(C)=O |
| InChI | InChI=1S/C4H6O2.C4H8O/c1-3(2)4(5)6;1-3-4(2)5/h1H2,2H3,(H,5,6);3H2,1-2H3 |
| InChIKey | DIEKHIOKJDOVQV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;2-methylprop-2-enoic acid?
The IUPAC name of butan-2-one;2-methylprop-2-enoic acid (CID 18674562) is butan-2-one;2-methylprop-2-enoic acid.
What is the SMILES notation for butan-2-one;2-methylprop-2-enoic acid?
The canonical SMILES for butan-2-one;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCC(C)=O.
What is the InChIKey of butan-2-one;2-methylprop-2-enoic acid?
The InChIKey is DIEKHIOKJDOVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C4H8O/c1-3(2)4(5)6;1-3-4(2)5/h1H2,2H3,(H,5,6);3H2,1-2H3.
What are the key properties of butan-2-one;2-methylprop-2-enoic acid?
butan-2-one;2-methylprop-2-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2-methylprop-2-enoic acid is sourced from PubChem (CID 18674562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).