C9H24O9S3Si — CID 175369116
CID 175369116 (PubChem CID 175369116) has the molecular formula C9H24O9S3Si and a molecular weight of 400.57 g/mol.
| Compound Name | CID 175369116 |
|---|---|
| PubChem CID | 175369116 |
| Molecular Formula | C9H24O9S3Si |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | — |
| SMILES | CCC[Si](OCC)(OCC)OCC.O=S(=O)(O)SS(=O)(=O)O |
| InChI | InChI=1S/C9H22O3Si.H2O6S3/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-8(2,3)7-9(4,5)6/h5-9H2,1-4H3;(H,1,2,3)(H,4,5,6) |
| InChIKey | VRBSBBDHXNIHRD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|