About 2-ethoxyethyl tripropyl silicate
2-ethoxyethyl tripropyl silicate (PubChem CID 139727074) has the molecular formula C13H30O5Si
and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-ethoxyethyl tripropyl silicate.
Molecular Properties
| Compound Name | 2-ethoxyethyl tripropyl silicate |
| PubChem CID | 139727074 |
| Molecular Formula | C13H30O5Si |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-ethoxyethyl tripropyl silicate |
| SMILES | CCCO[Si](OCCC)(OCCC)OCCOCC |
| InChI | InChI=1S/C13H30O5Si/c1-5-9-15-19(16-10-6-2,17-11-7-3)18-13-12-14-8-4/h5-13H2,1-4H3 |
| InChIKey | HWFCSAACBAOJLE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl tripropyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl tripropyl silicate?
The IUPAC name of 2-ethoxyethyl tripropyl silicate (CID 139727074) is 2-ethoxyethyl tripropyl silicate.
What is the SMILES notation for 2-ethoxyethyl tripropyl silicate?
The canonical SMILES for 2-ethoxyethyl tripropyl silicate is CCCO[Si](OCCC)(OCCC)OCCOCC.
What is the InChIKey of 2-ethoxyethyl tripropyl silicate?
The InChIKey is HWFCSAACBAOJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30O5Si/c1-5-9-15-19(16-10-6-2,17-11-7-3)18-13-12-14-8-4/h5-13H2,1-4H3.
What are the key properties of 2-ethoxyethyl tripropyl silicate?
2-ethoxyethyl tripropyl silicate has a molecular weight of 294.46 g/mol, XLogP of 2.75, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl tripropyl silicate is sourced from PubChem (CID 139727074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).