C7H12N6 — CID 130723153
2-[2-(pyrimidin-2-ylamino)ethyl]guanidine (PubChem CID 130723153) has the molecular formula C7H12N6 and a molecular weight of 180.22 g/mol. Its IUPAC name is 2-[2-(pyrimidin-2-ylamino)ethyl]guanidine.
| Compound Name | 2-[2-(pyrimidin-2-ylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 130723153 |
| Molecular Formula | C7H12N6 |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2-[2-(pyrimidin-2-ylamino)ethyl]guanidine |
| SMILES | NC(N)=NCCNc1ncccn1 |
| InChI | InChI=1S/C7H12N6/c8-6(9)10-4-5-13-7-11-2-1-3-12-7/h1-3H,4-5H2,(H4,8,9,10)(H,11,12,13) |
| InChIKey | KNEIYODCBFCSLG-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|