C8H15IN6 — CID 130686325
2-methyl-1-[2-(pyrimidin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 130686325) has the molecular formula C8H15IN6 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-methyl-1-[2-(pyrimidin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(pyrimidin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 130686325 |
| Molecular Formula | C8H15IN6 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-methyl-1-[2-(pyrimidin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\N)NCCNc1ncccn1.I |
| InChI | InChI=1S/C8H14N6.HI/c1-10-7(9)11-5-6-14-8-12-3-2-4-13-8;/h2-4H,5-6H2,1H3,(H3,9,10,11)(H,12,13,14);1H |
| InChIKey | BRUOMZCFNZEYLI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|