C12H27N11 — CID 54535550
2-methyl-1-[2-[[5-[[2-[(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]guanidine (PubChem CID 54535550) has the molecular formula C12H27N11 and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-methyl-1-[2-[[5-[[2-[(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-[[5-[[2-[(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 54535550 |
| Molecular Formula | C12H27N11 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 2-methyl-1-[2-[[5-[[2-[(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]guanidine |
| SMILES | C/N=C(\N)NCCNCc1n[nH]nc1CNCCN/C(N)=N/C |
| InChI | InChI=1S/C12H27N11/c1-15-11(13)19-5-3-17-7-9-10(22-23-21-9)8-18-4-6-20-12(14)16-2/h17-18H,3-8H2,1-2H3,(H3,13,15,19)(H3,14,16,20)(H,21,22,23) |
| InChIKey | YZNHCEDBDHSHIZ-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 166.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|