C12H25N9S2 — CID 20557773
1-[2-[[5-[[2-[carbamothioyl(methyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-1-methylthiourea (PubChem CID 20557773) has the molecular formula C12H25N9S2 and a molecular weight of 359.53 g/mol. Its IUPAC name is 1-[2-[[5-[[2-[carbamothioyl(methyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-1-methylthiourea.
| Compound Name | 1-[2-[[5-[[2-[carbamothioyl(methyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-1-methylthiourea |
|---|---|
| PubChem CID | 20557773 |
| Molecular Formula | C12H25N9S2 |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[2-[[5-[[2-[carbamothioyl(methyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-1-methylthiourea |
| SMILES | CN(CCNCc1n[nH]nc1CNCCN(C)C(N)=S)C(N)=S |
| InChI | InChI=1S/C12H25N9S2/c1-20(11(13)22)5-3-15-7-9-10(18-19-17-9)8-16-4-6-21(2)12(14)23/h15-16H,3-8H2,1-2H3,(H2,13,22)(H2,14,23)(H,17,18,19) |
| InChIKey | RUFZJACSJXBYLR-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|