C14H25N13 — CID 54154292
1-cyano-1-[2-[[5-[[2-[cyano-(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-2-methylguanidine (PubChem CID 54154292) has the molecular formula C14H25N13 and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-cyano-1-[2-[[5-[[2-[cyano-(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-2-methylguanidine.
| Compound Name | 1-cyano-1-[2-[[5-[[2-[cyano-(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 54154292 |
| Molecular Formula | C14H25N13 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 1-cyano-1-[2-[[5-[[2-[cyano-(N'-methylcarbamimidoyl)amino]ethylamino]methyl]-2H-triazol-4-yl]methylamino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N(C#N)CCNCc1n[nH]nc1CNCCN(C#N)/C(N)=N/C |
| InChI | InChI=1S/C14H25N13/c1-19-13(17)26(9-15)5-3-21-7-11-12(24-25-23-11)8-22-4-6-27(10-16)14(18)20-2/h21-22H,3-8H2,1-2H3,(H2,17,19)(H2,18,20)(H,23,24,25) |
| InChIKey | OJYAMONQQFOWAI-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 196.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|