C7H12N4S — CID 62407842
2-methyl-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 62407842) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 62407842 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-methyl-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | C/N=C(\N)NCCc1nccs1 |
| InChI | InChI=1S/C7H12N4S/c1-9-7(8)11-3-2-6-10-4-5-12-6/h4-5H,2-3H2,1H3,(H3,8,9,11) |
| InChIKey | ULPWWQUBOPPENN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|