About 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide
4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide (PubChem CID 66237908) has the molecular formula C10H15N3O2S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide |
| PubChem CID | 66237908 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide |
| SMILES | NC1COCC1C(=O)NCCc1nccs1 |
| InChI | InChI=1S/C10H15N3O2S/c11-8-6-15-5-7(8)10(14)13-2-1-9-12-3-4-16-9/h3-4,7-8H,1-2,5-6,11H2,(H,13,14) |
| InChIKey | LETDEMVSIKJEDY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide?
The IUPAC name of 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide (CID 66237908) is 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide.
What is the SMILES notation for 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide?
The canonical SMILES for 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide is NC1COCC1C(=O)NCCc1nccs1.
What is the InChIKey of 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide?
The InChIKey is LETDEMVSIKJEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c11-8-6-15-5-7(8)10(14)13-2-1-9-12-3-4-16-9/h3-4,7-8H,1-2,5-6,11H2,(H,13,14).
What are the key properties of 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide?
4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide has a molecular weight of 241.32 g/mol, XLogP of -0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[2-(1,3-thiazol-2-yl)ethyl]oxolane-3-carboxamide is sourced from PubChem (CID 66237908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).