C9H18N2O3 — CID 66239012
4-amino-N-(2-ethoxyethyl)oxolane-3-carboxamide (PubChem CID 66239012) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-amino-N-(2-ethoxyethyl)oxolane-3-carboxamide.
| Compound Name | 4-amino-N-(2-ethoxyethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66239012 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 4-amino-N-(2-ethoxyethyl)oxolane-3-carboxamide |
| SMILES | CCOCCNC(=O)C1COCC1N |
| InChI | InChI=1S/C9H18N2O3/c1-2-13-4-3-11-9(12)7-5-14-6-8(7)10/h7-8H,2-6,10H2,1H3,(H,11,12) |
| InChIKey | SBNIVUZUXGMCFD-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|