C12H20N4O2S — CID 76988657
2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(1,3-thiazol-2-yl)ethyl]butanamide (PubChem CID 76988657) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(1,3-thiazol-2-yl)ethyl]butanamide.
| Compound Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(1,3-thiazol-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 76988657 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-[2-(1,3-thiazol-2-yl)ethyl]butanamide |
| SMILES | CCC(CC)(C(=O)NCCc1nccs1)C(N)=NO |
| InChI | InChI=1S/C12H20N4O2S/c1-3-12(4-2,10(13)16-18)11(17)15-6-5-9-14-7-8-19-9/h7-8,18H,3-6H2,1-2H3,(H2,13,16)(H,15,17) |
| InChIKey | TVXRBSLPZCMHST-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|