C5H15N5 — CID 174332333
2-[2-(1-aminoethylamino)ethyl]guanidine (PubChem CID 174332333) has the molecular formula C5H15N5 and a molecular weight of 145.21 g/mol. Its IUPAC name is 2-[2-(1-aminoethylamino)ethyl]guanidine.
| Compound Name | 2-[2-(1-aminoethylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 174332333 |
| Molecular Formula | C5H15N5 |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 2-[2-(1-aminoethylamino)ethyl]guanidine |
| SMILES | CC(N)NCCN=C(N)N |
| InChI | InChI=1S/C5H15N5/c1-4(6)9-2-3-10-5(7)8/h4,9H,2-3,6H2,1H3,(H4,7,8,10) |
| InChIKey | WTQHYBRZPOAVDO-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|