About 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine
2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine (PubChem CID 20567703) has the molecular formula C7H13N5S
and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine.
Molecular Properties
| Compound Name | 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine |
| PubChem CID | 20567703 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine |
| SMILES | NC(N)=NCCNCc1cscn1 |
| InChI | InChI=1S/C7H13N5S/c8-7(9)11-2-1-10-3-6-4-13-5-12-6/h4-5,10H,1-3H2,(H4,8,9,11) |
| InChIKey | JGRXNGNGYHACRT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine?
The IUPAC name of 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine (CID 20567703) is 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine.
What is the SMILES notation for 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine?
The canonical SMILES for 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine is NC(N)=NCCNCc1cscn1.
What is the InChIKey of 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine?
The InChIKey is JGRXNGNGYHACRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5S/c8-7(9)11-2-1-10-3-6-4-13-5-12-6/h4-5,10H,1-3H2,(H4,8,9,11).
What are the key properties of 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine?
2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine has a molecular weight of 199.28 g/mol, XLogP of -0.49, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-thiazol-4-ylmethylamino)ethyl]guanidine is sourced from PubChem (CID 20567703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).