C8H14N4S2 — CID 20557651
1-methyl-3-[2-(1,3-thiazol-4-ylmethylamino)ethyl]thiourea (PubChem CID 20557651) has the molecular formula C8H14N4S2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 1-methyl-3-[2-(1,3-thiazol-4-ylmethylamino)ethyl]thiourea.
| Compound Name | 1-methyl-3-[2-(1,3-thiazol-4-ylmethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 20557651 |
| Molecular Formula | C8H14N4S2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-methyl-3-[2-(1,3-thiazol-4-ylmethylamino)ethyl]thiourea |
| SMILES | CNC(=S)NCCNCc1cscn1 |
| InChI | InChI=1S/C8H14N4S2/c1-9-8(13)11-3-2-10-4-7-5-14-6-12-7/h5-6,10H,2-4H2,1H3,(H2,9,11,13) |
| InChIKey | DULRUYHCQGZTHK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|