C9H16N4O2 — CID 135512453
(2S)-2-amino-5-[[amino-(prop-2-ynylamino)methylidene]amino]pentanoic acid (PubChem CID 135512453) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino-(prop-2-ynylamino)methylidene]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[amino-(prop-2-ynylamino)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 135512453 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2S)-2-amino-5-[[amino-(prop-2-ynylamino)methylidene]amino]pentanoic acid |
| SMILES | C#CCN/C(N)=N/CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H16N4O2/c1-2-5-12-9(11)13-6-3-4-7(10)8(14)15/h1,7H,3-6,10H2,(H,14,15)(H3,11,12,13)/t7-/m0/s1 |
| InChIKey | IAYULXZCALADJD-ZETCQYMHSA-N |
| XLogP | -1.28 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|