C7H16N4O2 — CID 11286925
(2S)-2-amino-4-[[amino(ethylamino)methylidene]amino]butanoic acid (PubChem CID 11286925) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2S)-2-amino-4-[[amino(ethylamino)methylidene]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[amino(ethylamino)methylidene]amino]butanoic acid |
|---|---|
| PubChem CID | 11286925 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2S)-2-amino-4-[[amino(ethylamino)methylidene]amino]butanoic acid |
| SMILES | CCN/C(N)=N/CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2/c1-2-10-7(9)11-4-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/t5-/m0/s1 |
| InChIKey | XKTHQOBBLUEFOX-YFKPBYRVSA-N |
| XLogP | -1.29 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|