C10H22N4O2 — CID 11390594
(2S)-2-amino-4-[[N'-(2,2-dimethylpropyl)carbamimidoyl]amino]butanoic acid (PubChem CID 11390594) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2S)-2-amino-4-[[N'-(2,2-dimethylpropyl)carbamimidoyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[N'-(2,2-dimethylpropyl)carbamimidoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 11390594 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2S)-2-amino-4-[[N'-(2,2-dimethylpropyl)carbamimidoyl]amino]butanoic acid |
| SMILES | CC(C)(C)C/N=C(\N)NCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H22N4O2/c1-10(2,3)6-14-9(12)13-5-4-7(11)8(15)16/h7H,4-6,11H2,1-3H3,(H,15,16)(H3,12,13,14)/t7-/m0/s1 |
| InChIKey | WUMPVYVGXAKGJB-ZETCQYMHSA-N |
| XLogP | -0.26 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|