C6H13N3O3 — CID 87289621
(2S)-2-amino-4-(methylcarbamoylamino)butanoic acid (PubChem CID 87289621) has the molecular formula C6H13N3O3 and a molecular weight of 175.19 g/mol. Its IUPAC name is (2S)-2-amino-4-(methylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-2-amino-4-(methylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 87289621 |
| Molecular Formula | C6H13N3O3 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (2S)-2-amino-4-(methylcarbamoylamino)butanoic acid |
| SMILES | CNC(=O)NCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3/c1-8-6(12)9-3-2-4(7)5(10)11/h4H,2-3,7H2,1H3,(H,10,11)(H2,8,9,12)/t4-/m0/s1 |
| InChIKey | MZPRQPGBEHSFQD-BYPYZUCNSA-N |
| XLogP | -1.28 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |