C11H22N4O3 — CID 67154377
(2S)-2-amino-4-(2-pyrrolidin-1-ylethylcarbamoylamino)butanoic acid (PubChem CID 67154377) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-2-amino-4-(2-pyrrolidin-1-ylethylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-2-amino-4-(2-pyrrolidin-1-ylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 67154377 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2S)-2-amino-4-(2-pyrrolidin-1-ylethylcarbamoylamino)butanoic acid |
| SMILES | N[C@@H](CCNC(=O)NCCN1CCCC1)C(=O)O |
| InChI | InChI=1S/C11H22N4O3/c12-9(10(16)17)3-4-13-11(18)14-5-8-15-6-1-2-7-15/h9H,1-8,12H2,(H,16,17)(H2,13,14,18)/t9-/m0/s1 |
| InChIKey | XDNWLBBPWCDLAP-VIFPVBQESA-N |
| XLogP | -0.82 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |