C30H63I2N7 — CID 176543865
1-[6-[6-[[amino-[(3,3-dimethylcyclohexyl)amino]methylidene]amino]hexylamino]hexyl]-2-(3,3-dimethylcyclohexyl)guanidine;dihydroiodide (PubChem CID 176543865) has the molecular formula C30H63I2N7 and a molecular weight of 775.69 g/mol. Its IUPAC name is 1-[6-[6-[[amino-[(3,3-dimethylcyclohexyl)amino]methylidene]amino]hexylamino]hexyl]-2-(3,3-dimethylcyclohexyl)guanidine;dihydroiodide.
| Compound Name | 1-[6-[6-[[amino-[(3,3-dimethylcyclohexyl)amino]methylidene]amino]hexylamino]hexyl]-2-(3,3-dimethylcyclohexyl)guanidine;dihydroiodide |
|---|---|
| PubChem CID | 176543865 |
| Molecular Formula | C30H63I2N7 |
| Molecular Weight | 775.69 g/mol |
| Exact Mass | 775.32 |
| IUPAC Name | 1-[6-[6-[[amino-[(3,3-dimethylcyclohexyl)amino]methylidene]amino]hexylamino]hexyl]-2-(3,3-dimethylcyclohexyl)guanidine;dihydroiodide |
| SMILES | CC1(C)CCCC(/N=C(\N)NCCCCCCNCCCCCC/N=C(\N)NC2CCCC(C)(C)C2)C1.I.I |
| InChI | InChI=1S/C30H61N7.2HI/c1-29(2)17-13-15-25(23-29)36-27(31)34-21-11-7-5-9-19-33-20-10-6-8-12-22-35-28(32)37-26-16-14-18-30(3,4)24-26;;/h25-26,33H,5-24H2,1-4H3,(H3,31,34,36)(H3,32,35,37);2*1H |
| InChIKey | LNEPTHFGVAKVTN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|