C17H36N10 — CID 176524346
1-[amino-[6-[[amino-(cyanoamino)methylidene]amino]hexylamino]methylidene]-2-(7-aminoheptyl)guanidine (PubChem CID 176524346) has the molecular formula C17H36N10 and a molecular weight of 380.55 g/mol. Its IUPAC name is 1-[amino-[6-[[amino-(cyanoamino)methylidene]amino]hexylamino]methylidene]-2-(7-aminoheptyl)guanidine.
| Compound Name | 1-[amino-[6-[[amino-(cyanoamino)methylidene]amino]hexylamino]methylidene]-2-(7-aminoheptyl)guanidine |
|---|---|
| PubChem CID | 176524346 |
| Molecular Formula | C17H36N10 |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 1-[amino-[6-[[amino-(cyanoamino)methylidene]amino]hexylamino]methylidene]-2-(7-aminoheptyl)guanidine |
| SMILES | N#CN/C(N)=N/CCCCCCNC(N)=N/C(N)=N/CCCCCCCN |
| InChI | InChI=1S/C17H36N10/c18-10-6-2-1-3-7-12-24-16(21)27-17(22)25-13-9-5-4-8-11-23-15(20)26-14-19/h1-13,18H2,(H3,20,23,26)(H5,21,22,24,25,27) |
| InChIKey | NUDRSKFFOZBVHW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 189.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|