C13H26N8 — CID 176680168
N'-cyanomethanimidamide;1-cyano-2-[8-(methylamino)octyl]guanidine (PubChem CID 176680168) has the molecular formula C13H26N8 and a molecular weight of 294.41 g/mol. Its IUPAC name is N'-cyanomethanimidamide;1-cyano-2-[8-(methylamino)octyl]guanidine.
| Compound Name | N'-cyanomethanimidamide;1-cyano-2-[8-(methylamino)octyl]guanidine |
|---|---|
| PubChem CID | 176680168 |
| Molecular Formula | C13H26N8 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | N'-cyanomethanimidamide;1-cyano-2-[8-(methylamino)octyl]guanidine |
| SMILES | CNCCCCCCCC/N=C(\N)NC#N.N#C/N=C/N |
| InChI | InChI=1S/C11H23N5.C2H3N3/c1-14-8-6-4-2-3-5-7-9-15-11(13)16-10-12;3-1-5-2-4/h14H,2-9H2,1H3,(H3,13,15,16);1H,(H2,3,5) |
| InChIKey | RRTUUMLTEIUVPC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|