C18H41ClN10 — CID 176529888
N'-[6-[[(E)-N'-[N'-[6-[(N'-methylcarbamimidoyl)amino]hexyl]carbamimidoyl]carbamimidoyl]amino]hexyl]ethanimidamide;hydrochloride (PubChem CID 176529888) has the molecular formula C18H41ClN10 and a molecular weight of 433.05 g/mol. Its IUPAC name is N'-[6-[[(E)-N'-[N'-[6-[(N'-methylcarbamimidoyl)amino]hexyl]carbamimidoyl]carbamimidoyl]amino]hexyl]ethanimidamide;hydrochloride.
| Compound Name | N'-[6-[[(E)-N'-[N'-[6-[(N'-methylcarbamimidoyl)amino]hexyl]carbamimidoyl]carbamimidoyl]amino]hexyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 176529888 |
| Molecular Formula | C18H41ClN10 |
| Molecular Weight | 433.05 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | N'-[6-[[(E)-N'-[N'-[6-[(N'-methylcarbamimidoyl)amino]hexyl]carbamimidoyl]carbamimidoyl]amino]hexyl]ethanimidamide;hydrochloride |
| SMILES | C/N=C(\N)NCCCCCC/N=C(N)/N=C(\N)NCCCCCC/N=C(\C)N.Cl |
| InChI | InChI=1S/C18H40N10.ClH/c1-15(19)24-11-7-3-4-9-13-26-17(21)28-18(22)27-14-10-6-5-8-12-25-16(20)23-2;/h3-14H2,1-2H3,(H2,19,24)(H3,20,23,25)(H5,21,22,26,27,28);1H |
| InChIKey | UBMKQBUDACGHSR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.05 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|