C9H20N3P — CID 123437912
2-methyl-1-(7-phosphanylideneheptyl)guanidine (PubChem CID 123437912) has the molecular formula C9H20N3P and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-methyl-1-(7-phosphanylideneheptyl)guanidine.
| Compound Name | 2-methyl-1-(7-phosphanylideneheptyl)guanidine |
|---|---|
| PubChem CID | 123437912 |
| Molecular Formula | C9H20N3P |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-methyl-1-(7-phosphanylideneheptyl)guanidine |
| SMILES | [H]/P=C/CCCCCCN/C(N)=N/C |
| InChI | InChI=1S/C9H20N3P/c1-11-9(10)12-7-5-3-2-4-6-8-13/h8,13H,2-7H2,1H3,(H3,10,11,12) |
| InChIKey | AADSKXGJCHFCFV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|