C7H17N4O2+ — CID 138397877
[(1R)-1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]azanium (PubChem CID 138397877) has the molecular formula C7H17N4O2+ and a molecular weight of 189.24 g/mol. Its IUPAC name is [(1R)-1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]azanium.
| Compound Name | [(1R)-1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]azanium |
|---|---|
| PubChem CID | 138397877 |
| Molecular Formula | C7H17N4O2+ |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | [(1R)-1-carboxy-4-[(N'-methylcarbamimidoyl)amino]butyl]azanium |
| SMILES | C/N=C(\N)NCCC[C@@H]([NH3+])C(=O)O |
| InChI | InChI=1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/p+1/t5-/m1/s1 |
| InChIKey | NTNWOCRCBQPEKQ-RXMQYKEDSA-O |
| XLogP | -2.00 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|