C12H27N4O2+ — CID 58636345
[1-butoxy-5-[(N,N'-dimethylcarbamimidoyl)amino]-1-oxopentan-2-yl]azanium (PubChem CID 58636345) has the molecular formula C12H27N4O2+ and a molecular weight of 259.37 g/mol. Its IUPAC name is [1-butoxy-5-[(N,N'-dimethylcarbamimidoyl)amino]-1-oxopentan-2-yl]azanium.
| Compound Name | [1-butoxy-5-[(N,N'-dimethylcarbamimidoyl)amino]-1-oxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 58636345 |
| Molecular Formula | C12H27N4O2+ |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | [1-butoxy-5-[(N,N'-dimethylcarbamimidoyl)amino]-1-oxopentan-2-yl]azanium |
| SMILES | CCCCOC(=O)C([NH3+])CCCN/C(=N/C)NC |
| InChI | InChI=1S/C12H26N4O2/c1-4-5-9-18-11(17)10(13)7-6-8-16-12(14-2)15-3/h10H,4-9,13H2,1-3H3,(H2,14,15,16)/p+1 |
| InChIKey | QDMXDFOZSIDMBQ-UHFFFAOYSA-O |
| XLogP | -0.48 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|