C17H36N6O2S — CID 122498401
2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-oxo-2-(pentylamino)ethyl]sulfanylethyl]pentanamide (PubChem CID 122498401) has the molecular formula C17H36N6O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-oxo-2-(pentylamino)ethyl]sulfanylethyl]pentanamide.
| Compound Name | 2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-oxo-2-(pentylamino)ethyl]sulfanylethyl]pentanamide |
|---|---|
| PubChem CID | 122498401 |
| Molecular Formula | C17H36N6O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-oxo-2-(pentylamino)ethyl]sulfanylethyl]pentanamide |
| SMILES | CCCCCNC(=O)CSCCNC(=O)C(N)CCCN/C(=N/C)NC |
| InChI | InChI=1S/C17H36N6O2S/c1-4-5-6-9-21-15(24)13-26-12-11-22-16(25)14(18)8-7-10-23-17(19-2)20-3/h14H,4-13,18H2,1-3H3,(H,21,24)(H,22,25)(H2,19,20,23) |
| InChIKey | BIWNQEPSBSYVSP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|