C29H58N6O2S — CID 170277177
2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-[4-[(1S)-1,5-dimethylcycloundecyl]butylamino]-2-oxoethyl]sulfanylethyl]pentanamide (PubChem CID 170277177) has the molecular formula C29H58N6O2S and a molecular weight of 554.89 g/mol. Its IUPAC name is 2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-[4-[(1S)-1,5-dimethylcycloundecyl]butylamino]-2-oxoethyl]sulfanylethyl]pentanamide.
| Compound Name | 2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-[4-[(1S)-1,5-dimethylcycloundecyl]butylamino]-2-oxoethyl]sulfanylethyl]pentanamide |
|---|---|
| PubChem CID | 170277177 |
| Molecular Formula | C29H58N6O2S |
| Molecular Weight | 554.89 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | 2-amino-5-[(N,N'-dimethylcarbamimidoyl)amino]-N-[2-[2-[4-[(1S)-1,5-dimethylcycloundecyl]butylamino]-2-oxoethyl]sulfanylethyl]pentanamide |
| SMILES | C/N=C(\NC)NCCCC(N)C(=O)NCCSCC(=O)NCCCC[C@@]1(C)CCCCCCC(C)CCC1 |
| InChI | InChI=1S/C29H58N6O2S/c1-24-13-7-5-6-8-16-29(2,18-11-14-24)17-9-10-19-33-26(36)23-38-22-21-34-27(37)25(30)15-12-20-35-28(31-3)32-4/h24-25H,5-23,30H2,1-4H3,(H,33,36)(H,34,37)(H2,31,32,35)/t24?,25?,29-/m1/s1 |
| InChIKey | YXQQFLGFOXWVTP-KZNPQIALSA-N |
| XLogP | 4.19 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|