C8H20N4O2+2 — CID 53497586
[[[(4S)-4-azaniumyl-4-carboxybutyl]amino]-(methylamino)methylidene]-methylazanium (PubChem CID 53497586) has the molecular formula C8H20N4O2+2 and a molecular weight of 204.27 g/mol. Its IUPAC name is [[[(4S)-4-azaniumyl-4-carboxybutyl]amino]-(methylamino)methylidene]-methylazanium.
| Compound Name | [[[(4S)-4-azaniumyl-4-carboxybutyl]amino]-(methylamino)methylidene]-methylazanium |
|---|---|
| PubChem CID | 53497586 |
| Molecular Formula | C8H20N4O2+2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [[[(4S)-4-azaniumyl-4-carboxybutyl]amino]-(methylamino)methylidene]-methylazanium |
| SMILES | CN/C(NCCC[C@H]([NH3+])C(=O)O)=[NH+]\C |
| InChI | InChI=1S/C8H18N4O2/c1-10-8(11-2)12-5-3-4-6(9)7(13)14/h6H,3-5,9H2,1-2H3,(H,13,14)(H2,10,11,12)/p+2/t6-/m0/s1 |
| InChIKey | HVPFXCBJHIIJGS-LURJTMIESA-P |
| XLogP | -3.66 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|