4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid

C11H21NO4 — CID 106120319

IUPAC4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(O)CCCNC(=O)C(C)C(C)C(=O)O
InChIInChI=1S/C11H21NO4/c1-7(13)5-4-6-12-10(14)8(2)9(3)11(15)16/h7-9,13H,4-6H2,1-3H3,(H,12,14)(H,15,16)
InChIKeyJWWIWCPZLOJWQP-UHFFFAOYSA-N
MW231.29 g/mol
LogP0.62
Rot. Bonds7

About 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid

4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 106120319) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID106120319
Molecular FormulaC11H21NO4
Molecular Weight231.29 g/mol
Exact Mass231.15
IUPAC Name4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(O)CCCNC(=O)C(C)C(C)C(=O)O
InChIInChI=1S/C11H21NO4/c1-7(13)5-4-6-12-10(14)8(2)9(3)11(15)16/h7-9,13H,4-6H2,1-3H3,(H,12,14)(H,15,16)
InChIKeyJWWIWCPZLOJWQP-UHFFFAOYSA-N
XLogP0.62
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.29
LogP ≤ 50.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid (CID 106120319) is 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid is CC(O)CCCNC(=O)C(C)C(C)C(=O)O.
What is the InChIKey of 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is JWWIWCPZLOJWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-7(13)5-4-6-12-10(14)8(2)9(3)11(15)16/h7-9,13H,4-6H2,1-3H3,(H,12,14)(H,15,16).
What are the key properties of 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid?
4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 231.29 g/mol, XLogP of 0.62, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxypentylamino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 106120319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).