C13H25N3O4 — CID 58351884
(2R)-5-[(N'-methylcarbamimidoyl)amino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid (PubChem CID 58351884) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2R)-5-[(N'-methylcarbamimidoyl)amino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid.
| Compound Name | (2R)-5-[(N'-methylcarbamimidoyl)amino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
|---|---|
| PubChem CID | 58351884 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (2R)-5-[(N'-methylcarbamimidoyl)amino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
| SMILES | C/N=C(\N)NCCCC(CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H25N3O4/c1-13(2,3)20-10(17)8-9(11(18)19)6-5-7-16-12(14)15-4/h9H,5-8H2,1-4H3,(H,18,19)(H3,14,15,16) |
| InChIKey | YFMWISNVCXEBKZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|