C23H47N7O7 — CID 176574763
tert-butyl (3S)-3-[[2-[[5-[(N'-methylcarbamimidoyl)amino]-2-(propanoylamino)pentanoyl]amino]acetyl]amino]butanoate;ethane;N-hydroxyformamide (PubChem CID 176574763) has the molecular formula C23H47N7O7 and a molecular weight of 533.67 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-[[5-[(N'-methylcarbamimidoyl)amino]-2-(propanoylamino)pentanoyl]amino]acetyl]amino]butanoate;ethane;N-hydroxyformamide.
| Compound Name | tert-butyl (3S)-3-[[2-[[5-[(N'-methylcarbamimidoyl)amino]-2-(propanoylamino)pentanoyl]amino]acetyl]amino]butanoate;ethane;N-hydroxyformamide |
|---|---|
| PubChem CID | 176574763 |
| Molecular Formula | C23H47N7O7 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | tert-butyl (3S)-3-[[2-[[5-[(N'-methylcarbamimidoyl)amino]-2-(propanoylamino)pentanoyl]amino]acetyl]amino]butanoate;ethane;N-hydroxyformamide |
| SMILES | CC.CCC(=O)NC(CCCN/C(N)=N/C)C(=O)NCC(=O)N[C@@H](C)CC(=O)OC(C)(C)C.O=CNO |
| InChI | InChI=1S/C20H38N6O5.C2H6.CH3NO2/c1-7-15(27)26-14(9-8-10-23-19(21)22-6)18(30)24-12-16(28)25-13(2)11-17(29)31-20(3,4)5;1-2;3-1-2-4/h13-14H,7-12H2,1-6H3,(H,24,30)(H,25,28)(H,26,27)(H3,21,22,23);1-2H3;1,4H,(H,2,3)/t13-,14?;;/m0../s1 |
| InChIKey | KCKLBAYDKUTYAS-RBUUAABPSA-N |
| XLogP | -0.30 |
| TPSA | 213.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|