C22H39N5O4 — CID 90329720
(2R)-N-[2-[[(4R)-1-(1-aminoethenylamino)-6-methyl-5-oxooct-7-en-4-yl]amino]-2-oxoethyl]-2-(propanoylamino)hexanamide (PubChem CID 90329720) has the molecular formula C22H39N5O4 and a molecular weight of 437.59 g/mol. Its IUPAC name is (2R)-N-[2-[[(4R)-1-(1-aminoethenylamino)-6-methyl-5-oxooct-7-en-4-yl]amino]-2-oxoethyl]-2-(propanoylamino)hexanamide.
| Compound Name | (2R)-N-[2-[[(4R)-1-(1-aminoethenylamino)-6-methyl-5-oxooct-7-en-4-yl]amino]-2-oxoethyl]-2-(propanoylamino)hexanamide |
|---|---|
| PubChem CID | 90329720 |
| Molecular Formula | C22H39N5O4 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | (2R)-N-[2-[[(4R)-1-(1-aminoethenylamino)-6-methyl-5-oxooct-7-en-4-yl]amino]-2-oxoethyl]-2-(propanoylamino)hexanamide |
| SMILES | C=CC(C)C(=O)[C@@H](CCCNC(=C)N)NC(=O)CNC(=O)[C@@H](CCCC)NC(=O)CC |
| InChI | InChI=1S/C22H39N5O4/c1-6-9-11-18(27-19(28)8-3)22(31)25-14-20(29)26-17(21(30)15(4)7-2)12-10-13-24-16(5)23/h7,15,17-18,24H,2,5-6,8-14,23H2,1,3-4H3,(H,25,31)(H,26,29)(H,27,28)/t15?,17-,18-/m1/s1 |
| InChIKey | RRRILSKBOVUDDC-HSFDIDPMSA-N |
| XLogP | 0.86 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|