About methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate
methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate (PubChem CID 158179175) has the molecular formula C16H28N2O5
and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate |
| PubChem CID | 158179175 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate |
| SMILES | CCCC[C@@H](NC(=O)CC)C(=O)C[C@H](C)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C16H28N2O5/c1-5-7-8-12(18-14(20)6-2)13(19)9-11(3)16(22)17-10-15(21)23-4/h11-12H,5-10H2,1-4H3,(H,17,22)(H,18,20)/t11-,12+/m0/s1 |
| InChIKey | JLKJEHGHMMMDEI-NWDGAFQWSA-N |
| XLogP | 0.96 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate?
The IUPAC name of methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate (CID 158179175) is methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate.
What is the SMILES notation for methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate?
The canonical SMILES for methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate is CCCC[C@@H](NC(=O)CC)C(=O)C[C@H](C)C(=O)NCC(=O)OC.
What is the InChIKey of methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate?
The InChIKey is JLKJEHGHMMMDEI-NWDGAFQWSA-N. The full InChI is InChI=1S/C16H28N2O5/c1-5-7-8-12(18-14(20)6-2)13(19)9-11(3)16(22)17-10-15(21)23-4/h11-12H,5-10H2,1-4H3,(H,17,22)(H,18,20)/t11-,12+/m0/s1.
What are the key properties of methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate?
methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate has a molecular weight of 328.41 g/mol, XLogP of 0.96, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S,5R)-2-methyl-4-oxo-5-(propanoylamino)nonanoyl]amino]acetate is sourced from PubChem (CID 158179175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).