C18H33N3O5 — CID 607811
methyl 2-[[2-[2-(decanoylamino)propanoylamino]acetyl]amino]acetate (PubChem CID 607811) has the molecular formula C18H33N3O5 and a molecular weight of 371.48 g/mol. Its IUPAC name is methyl 2-[[2-[2-(decanoylamino)propanoylamino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[2-(decanoylamino)propanoylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 607811 |
| Molecular Formula | C18H33N3O5 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | methyl 2-[[2-[2-(decanoylamino)propanoylamino]acetyl]amino]acetate |
| SMILES | CCCCCCCCCC(=O)NC(C)C(=O)NCC(=O)NCC(=O)OC |
| InChI | InChI=1S/C18H33N3O5/c1-4-5-6-7-8-9-10-11-15(22)21-14(2)18(25)20-12-16(23)19-13-17(24)26-3/h14H,4-13H2,1-3H3,(H,19,23)(H,20,25)(H,21,22) |
| InChIKey | DCASDXWAVWVOIQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|