C18H33N3O5S2 — CID 144752158
methyl 4-[[4-[[1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-4-oxobutyl]disulfanyl]-4-methylpentanoate (PubChem CID 144752158) has the molecular formula C18H33N3O5S2 and a molecular weight of 435.61 g/mol. Its IUPAC name is methyl 4-[[4-[[1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-4-oxobutyl]disulfanyl]-4-methylpentanoate.
| Compound Name | methyl 4-[[4-[[1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-4-oxobutyl]disulfanyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 144752158 |
| Molecular Formula | C18H33N3O5S2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | methyl 4-[[4-[[1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-4-oxobutyl]disulfanyl]-4-methylpentanoate |
| SMILES | CCNC(=O)CNC(=O)C(C)NC(=O)CCCSSC(C)(C)CCC(=O)OC |
| InChI | InChI=1S/C18H33N3O5S2/c1-6-19-15(23)12-20-17(25)13(2)21-14(22)8-7-11-27-28-18(3,4)10-9-16(24)26-5/h13H,6-12H2,1-5H3,(H,19,23)(H,20,25)(H,21,22) |
| InChIKey | IVVYHFVWBCOSMD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|