C24H47NO2S2 — CID 118423529
4-[(6-ethyl-2,6-dimethyl-5-oxooctan-2-yl)disulfanyl]-N-(3-ethyl-3-methylpentyl)butanamide (PubChem CID 118423529) has the molecular formula C24H47NO2S2 and a molecular weight of 445.78 g/mol. Its IUPAC name is 4-[(6-ethyl-2,6-dimethyl-5-oxooctan-2-yl)disulfanyl]-N-(3-ethyl-3-methylpentyl)butanamide.
| Compound Name | 4-[(6-ethyl-2,6-dimethyl-5-oxooctan-2-yl)disulfanyl]-N-(3-ethyl-3-methylpentyl)butanamide |
|---|---|
| PubChem CID | 118423529 |
| Molecular Formula | C24H47NO2S2 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 4-[(6-ethyl-2,6-dimethyl-5-oxooctan-2-yl)disulfanyl]-N-(3-ethyl-3-methylpentyl)butanamide |
| SMILES | CCC(C)(CC)CCNC(=O)CCCSSC(C)(C)CCC(=O)C(C)(CC)CC |
| InChI | InChI=1S/C24H47NO2S2/c1-9-23(7,10-2)17-18-25-21(27)14-13-19-28-29-22(5,6)16-15-20(26)24(8,11-3)12-4/h9-19H2,1-8H3,(H,25,27) |
| InChIKey | MEVUGUJLIFWYHL-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|