C12H23NO2S2 — CID 144752145
4-[3-(ethylamino)but-3-enyldisulfanyl]-4-methylpentanoic acid (PubChem CID 144752145) has the molecular formula C12H23NO2S2 and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[3-(ethylamino)but-3-enyldisulfanyl]-4-methylpentanoic acid.
| Compound Name | 4-[3-(ethylamino)but-3-enyldisulfanyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 144752145 |
| Molecular Formula | C12H23NO2S2 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-[3-(ethylamino)but-3-enyldisulfanyl]-4-methylpentanoic acid |
| SMILES | C=C(CCSSC(C)(C)CCC(=O)O)NCC |
| InChI | InChI=1S/C12H23NO2S2/c1-5-13-10(2)7-9-16-17-12(3,4)8-6-11(14)15/h13H,2,5-9H2,1,3-4H3,(H,14,15) |
| InChIKey | LPYAESVMRFIRAX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|