C13H24BNO3S2 — CID 145224351
CID 145224351 (PubChem CID 145224351) has the molecular formula C13H24BNO3S2 and a molecular weight of 317.28 g/mol.
| Compound Name | CID 145224351 |
|---|---|
| PubChem CID | 145224351 |
| Molecular Formula | C13H24BNO3S2 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)/C=N/OCCCSSC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C13H24BNO3S2/c1-12(2,14)10-15-18-8-5-9-19-20-13(3,4)7-6-11(16)17/h10H,5-9H2,1-4H3,(H,16,17)/b15-10+ |
| InChIKey | ITPMLHWGXBCQNO-XNTDXEJSSA-N |
| XLogP | 3.77 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|