C26H42N2O2S2 — CID 129072572
N-[2-[[4-methyl-4-(5-methylhexyldisulfanyl)pentanoyl]amino]ethyl]-4-(2-methylprop-1-enyl)benzamide (PubChem CID 129072572) has the molecular formula C26H42N2O2S2 and a molecular weight of 478.77 g/mol. Its IUPAC name is N-[2-[[4-methyl-4-(5-methylhexyldisulfanyl)pentanoyl]amino]ethyl]-4-(2-methylprop-1-enyl)benzamide.
| Compound Name | N-[2-[[4-methyl-4-(5-methylhexyldisulfanyl)pentanoyl]amino]ethyl]-4-(2-methylprop-1-enyl)benzamide |
|---|---|
| PubChem CID | 129072572 |
| Molecular Formula | C26H42N2O2S2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-[2-[[4-methyl-4-(5-methylhexyldisulfanyl)pentanoyl]amino]ethyl]-4-(2-methylprop-1-enyl)benzamide |
| SMILES | CC(C)=Cc1ccc(C(=O)NCCNC(=O)CCC(C)(C)SSCCCCC(C)C)cc1 |
| InChI | InChI=1S/C26H42N2O2S2/c1-20(2)9-7-8-18-31-32-26(5,6)15-14-24(29)27-16-17-28-25(30)23-12-10-22(11-13-23)19-21(3)4/h10-13,19-20H,7-9,14-18H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | QXLILINPIXXYDO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|