C18H32IN3O3S — CID 119146101
1-(2-bicyclo[2.2.1]heptanyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119146101) has the molecular formula C18H32IN3O3S and a molecular weight of 497.44 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119146101 |
| Molecular Formula | C18H32IN3O3S |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.O=S1(=O)CCC(C/N=C(\NCC2CCCO2)NC2CC3CCC2C3)C1 |
| InChI | InChI=1S/C18H31N3O3S.HI/c22-25(23)7-5-14(12-25)10-19-18(20-11-16-2-1-6-24-16)21-17-9-13-3-4-15(17)8-13;/h13-17H,1-12H2,(H2,19,20,21);1H |
| InChIKey | TWYBVRSYGOGGPV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|