C20H32IN3O3S — CID 111620039
1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111620039) has the molecular formula C20H32IN3O3S and a molecular weight of 521.47 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620039 |
| Molecular Formula | C20H32IN3O3S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C20H31N3O3S.HI/c1-15-5-7-17(8-6-15)19-18(4-3-10-26-19)13-23-20(21-2)22-12-16-9-11-27(24,25)14-16;/h5-8,16,18-19H,3-4,9-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | NPKFRRDWIHPNNY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|