C24H41IN4O — CID 111620763
2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111620763) has the molecular formula C24H41IN4O and a molecular weight of 528.52 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620763 |
| Molecular Formula | C24H41IN4O |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCN(C(C)C)C1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C24H40N4O.HI/c1-18(2)28-13-5-7-20(17-28)15-26-24(25-4)27-16-22-8-6-14-29-23(22)21-11-9-19(3)10-12-21;/h9-12,18,20,22-23H,5-8,13-17H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | HVYUEVFNEQQNNX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|